http://debianws.lexgopc.com/wiki143/index.php?action=history&feed=atom&title=Nimustine
Nimustine - Revision history
2026-05-14T09:16:57Z
Revision history for this page on the wiki
MediaWiki 1.43.1
http://debianws.lexgopc.com/wiki143/index.php?title=Nimustine&diff=6996316&oldid=prev
imported>JWBE: removed Category:Organochlorides using HotCat
2025-04-17T08:37:52Z
<p>removed <a href="/wiki143/index.php?title=Category:Organochlorides" title="Category:Organochlorides">Category:Organochlorides</a> using <a href="/wiki143/index.php?title=WP:HC&action=edit&redlink=1" class="new" title="WP:HC (page does not exist)">HotCat</a></p>
<p><b>New page</b></p><div>{{Short description|Chemical compound}}<br />
{{Drugbox<br />
| Verifiedfields = changed<br />
| verifiedrevid = 444554365<br />
| IUPAC_name = ''N<nowiki>'</nowiki>''-[(4-amino-2-methylpyrimidin-5-yl)methyl]-''N''-(2-chloroethyl)-''N''-nitrosourea<br />
| image = Nimustine.svg<br />
| alt = Structural formula of Nimustine<br />
| width = 225px<br />
| image2 = Nimustine 3D spacefill.png<br />
| alt2 = Space-filling model of the nimustine molecule<br />
| width2 = 225px<br />
<br />
<!--Clinical data--><br />
| tradename = <br />
| Drugs.com = {{drugs.com|international|nimustine}}<br />
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --><br />
| pregnancy_US = <!-- A / B / C / D / X --><br />
| pregnancy_category = <br />
| legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled--><br />
| legal_CA = <!-- Schedule I, II, III, IV, V, VI, VII, VIII --><br />
| legal_UK = <!-- GSL, P, POM, CD, or Class A, B, C --><br />
| legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --><br />
| legal_status = Rx-only<br />
| routes_of_administration = [[Intravenous therapy|Intravenous]]<br />
<br />
<!--Pharmacokinetic data--><br />
| bioavailability = <br />
| protein_bound = <br />
| metabolism = <br />
| elimination_half-life = <br />
| excretion = <br />
<br />
<!--Identifiers--><br />
| CAS_number_Ref = {{cascite|correct|??}}<br />
| CAS_number = 42471-28-3<br />
| ATC_prefix = L01<br />
| ATC_suffix = AD06<br />
| ATC_supplemental = <br />
| PubChem = 39214<br />
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}<br />
| DrugBank = <br />
| UNII_Ref = {{fdacite|correct|FDA}}<br />
| UNII = 0S726V972K<br />
| KEGG_Ref = {{keggcite|correct|kegg}}<br />
| KEGG = D08276<br />
| ChEBI_Ref = {{ebicite|changed|EBI}}<br />
| ChEBI = 75270<br />
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}<br />
| ChemSpiderID = 35876<br />
<br />
<!--Chemical data--><br />
| C=9 | H=13 | Cl=1 | N=6 | O=2 <br />
| SMILES = CC1=NC=C(C(=N1)N)CNC(=O)N(CCCl)N=O<br />
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}<br />
| StdInChI = 1S/C9H13ClN6O2/c1-6-12-4-7(8(11)14-6)5-13-9(17)16(15-18)3-2-10/h4H,2-3,5H2,1H3,(H,13,17)(H2,11,12,14)<br />
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}<br />
| StdInChIKey = VFEDRRNHLBGPNN-UHFFFAOYSA-N<br />
}}<br />
<br />
'''Nimustine''' ({{abbrlink|INN|International Nonproprietary Name}}) is a [[nitrosourea]] [[alkylating antineoplastic agent|alkylating agent]].<ref>{{Cite web|url=https://www.cancer.gov/publications/dictionaries/cancer-drug/def/nimustine|title=NCI Drug Dictionary|website=National Cancer Institute|language=en|access-date=2019-03-17}}</ref><br />
<br />
It is used to treat malignant brain tumors and has proven to be rather effective.<ref>[https://www.ebi.ac.uk/chebi/searchId.do?chebiId=CHEBI:75270 CHEBI:75270 - nimustine] </ref><ref name="pmid31414134">{{cite journal | vauthors = Endo T, Inoue T, Sugiyama S, Saito R, Tominaga T | title = Regression of Recurrent Spinal Cord High-Grade Glioma After Convection-Enhanced Delivery of Nimustine Hydrochloride: Case Reports and Literature Review | journal = Operative Neurosurgery (Hagerstown, Md.) | volume = 18 | issue = 4 | pages = 451–459 | date = April 2020 | pmid = 31414134 | doi = 10.1093/ons/opz172 }}</ref><br />
<br />
==References==<br />
{{Reflist}}<br />
<br />
<br />
{{Chemotherapeutic agents}}<br />
<br />
[[Category:Alkylating antineoplastic agents]]<br />
[[Category:Nitrosamines]]<br />
[[Category:Nitrosoureas]]<br />
[[Category:Pyrimidines]]<br />
[[Category:Ureas]]<br />
[[Category:Chloroethyl compounds]]<br />
<br />
{{Antineoplastic-drug-stub}}</div>
imported>JWBE