View source for Trimetrexate

{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 470615984
| IUPAC_name = 5-methyl-6-[(3,4,5-trimethoxyphenyl) aminomethyl] quinazoline-2,4-diamine
| image = Trimetrexate.svg
| width = 250
<!--Clinical data-->
| tradename =
| Drugs.com = {{drugs.com|CDI|trimetrexate}}
| MedlinePlus = a694019
| pregnancy_category =
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability = VD: 20-30 Liters
| protein_bound =
| metabolism = Oxidative O-demethylation, followed by conjugation with glucuronide or sulfate
| elimination_half-life = 11 to 12 hours
<!--Identifiers-->
| IUPHAR_ligand = 7613
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 52128-35-5
| ATC_prefix = P01
| ATC_suffix = AX07
| ATC_supplemental =
| PubChem = 5583
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01157
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5381
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = UPN4ITI8T4
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D06238
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 119
<!--Chemical data-->
| C=19 | H=23 | N=5 | O=3
| smiles = n3c1c(c(c(cc1)CNc2cc(OC)c(OC)c(OC)c2)C)c(nc3N)N
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C19H23N5O3/c1-10-11(5-6-13-16(10)18(20)24-19(21)23-13)9-22-12-7-14(25-2)17(27-4)15(8-12)26-3/h5-8,22H,9H2,1-4H3,(H4,20,21,23,24)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = NOYPYLRCIDNJJB-UHFFFAOYSA-N
}}

'''Trimetrexate''' is a [[quinazoline]] derivative. It is a [[dihydrofolate reductase inhibitor]].<ref name="pmid1981548">{{cite journal |vauthors =Wong BK, Woolf TF, Chang T, Whitfield LR |title=Metabolic disposition of trimetrexate, a nonclassical dihydrofolate reductase inhibitor, in rat and dog |journal=Drug Metab. Dispos. |volume=18 |issue=6 |pages=980–6 |year=1990 |pmid=1981548 |url=http://dmd.aspetjournals.org/cgi/pmidlookup?view=long&pmid=1981548}}</ref>

==Uses==
It has been used with [[leucovorin]] in treating [[pneumocystis pneumonia]].<ref name="pmid2136905">{{cite journal  |vauthors=Sattler FR, Allegra CJ, Verdegem TD, etal |title=Trimetrexate-leucovorin dosage evaluation study for treatment of Pneumocystis carinii pneumonia |journal=J. Infect. Dis. |volume=161 |issue=1 |pages=91–6 |date=January 1990 |pmid=2136905 |doi= 10.1093/infdis/161.1.91}}</ref>

It has been investigated for use in treating [[leiomyosarcoma]].<ref name="pmid11748990">{{cite journal |vauthors =Smith HO, Blessing JA, Vaccarello L |title=Trimetrexate in the treatment of recurrent or advanced leiomyosarcoma of the uterus: a phase II study of the Gynecologic Oncology Group |journal=Gynecol. Oncol. |volume=84 |issue=1 |pages=140–4 |date=January 2002 |pmid=11748990 |doi=10.1006/gyno.2001.6482 }}</ref>
It is a [[methotrexate]] (MTX) analog that is active against transport-deficient MTX-resistant tumor cells that overcome the acquired and natural resistance to methotrexate.  Other uses include skin lymphoma. <ref>Trimetrexate in relapsed T-cell lymphoma with skin involvement. J Clin Oncol. 2002 Jun 15;20(12):2876-80.</ref>

==References==
{{reflist}}

==External links==
* {{MedlinePlusDrugInfo|uspdi|202693}}
* {{DiseasesDB|30480}}

{{Agents against amoebiasis and other protozoal diseases}}

[[Category:Antifungals]]
[[Category:Mammalian dihydrofolate reductase inhibitors]]
[[Category:Protozoal dihydrofolate reductase inhibitors]]
[[Category:Fungal dihydrofolate reductase inhibitors]]
[[Category:Quinazolines]]
[[Category:Antiprotozoal agents]]
[[Category:Aromatic amines]]
[[Category:Phenol ethers]]
[[Category:Anilines]]


{{antimicrobial-stub}}