View source for Thiamylal

{{Short description|Chemical compound}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 470606310
| IUPAC_name = 5-(Pentan-2-yl)-5-(prop-2-en-1-yl)-2-sulfanylidenedihydropyrimidine-4,6(1''H'',5''H'')-dione
| image = ThiamylalSVG.svg
| image_class = skin-invert-image
| width = 100
<!--Clinical data-->
| tradename =  
| Drugs.com = {{drugs.com|international|thiamylal}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_BR = B1
| legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-03-31 |title=RDC Nº 784 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 784 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |url-status=live |archive-url=https://web.archive.org/web/20230803143925/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-784-de-31-de-marco-de-2023-474904992 |archive-date=2023-08-03 |access-date=2023-08-16 |publisher=[[Diário Oficial da União]] |language=pt-BR |publication-date=2023-04-04}}</ref>
| legal_CA = Schedule IV
| legal_UK = <!-- GSL         / P       / POM / CD / Class A, B, C -->
| legal_US = Schedule III
| legal_status =  
| routes_of_administration =  
<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism = Hepatic
| elimination_half-life = 14.3 h (cats)
| excretion =  
<!--Identifiers-->
| IUPHAR_ligand = 7305
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 77-27-0
| ATCvet = yes
| ATC_prefix = N01
| ATC_suffix = AF90
| PubChem = 3032285
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01154
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 2297298
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 01T23W89FR
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D06106
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 9536
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 440
<!--Chemical data-->
| C=12 | H=18 | N=2 | O=2 | S=1
| smiles = O=C1NC(=S)NC(=O)C1(C(C)CCC)C\C=C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C12H18N2O2S/c1-4-6-8(3)12(7-5-2)9(15)13-11(17)14-10(12)16/h5,8H,2,4,6-7H2,1,3H3,(H2,13,14,15,16,17)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = XLOMZPUITCYLMJ-UHFFFAOYSA-N
| synonyms = Thiamylal, Thioseconal, Surital
}}

'''Thiamylal''' ('''Surital''') is a [[barbiturate]] derivative invented in the 1950s. It has [[sedative]], [[anticonvulsant]], and [[hypnotic]] effects, and is used as a strong but short acting sedative. Thiamylal is still in current use, primarily for induction in [[surgical]] [[anaesthesia]]<ref name="pmid16640004">{{cite journal | vauthors = Hsieh MY, Hung GY, Hsieh YL, Chang CY, Hwang B | title = Deep sedation with methohexital or thiamylal with midazolam for invasive procedures in children with acute lymphoblastic leukemia | journal = Acta Paediatrica Taiwanica = Taiwan Er Ke Yi Xue Hui Za Zhi | volume = 46 | issue = 5 | pages = 294–300 | date = 2005 | pmid = 16640004 }}</ref> or as an anticonvulsant to counteract side effects from other anaesthetics.<ref name="pmid17339174">{{cite journal | vauthors = Tsai CJ, Wang HM, Lu IC, Tai CF, Wang LF, Soo LY, Lu DV | title = Seizure after local anesthesia for nasopharyngeal angiofibroma | journal = The Kaohsiung Journal of Medical Sciences | volume = 23 | issue = 2 | pages = 97–100 | date = February 2007 | pmid = 17339174 | doi = 10.1016/S1607-551X(09)70383-3 | doi-access = free }}</ref> It is the thiobarbiturate analogue of [[secobarbital]].

== References ==
<references />

{{Sedatives}}
{{GABAA receptor positive modulators}}
{{Xenobiotic-sensing receptor modulators}}
{{General anesthetics}}

[[Category:Thiobarbiturates]]
[[Category:GABAA receptor positive allosteric modulators]]
[[Category:Allyl compounds]]


{{sedative-stub}}