View source for Spiroxatrine

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 470470273
| ImageFile = Spiroxatrine.svg
| ImageSize = 225
| IUPACName = 8-(2,3-Dihydro-1,4-benzodioxin-2-ylmethyl)-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one
| OtherNames =

| Section1 = {{Chembox Identifiers
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = DR0QR50ALL
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 5078
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 300555
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C22H25N3O3/c26-21-22(25(16-23-21)17-6-2-1-3-7-17)10-12-24(13-11-22)14-18-15-27-19-8-4-5-9-20(19)28-18/h1-9,18H,10-16H2,(H,23,26)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = JVGBTTIJPBFLTE-UHFFFAOYSA-N
| CASNo_Ref = {{cascite|changed|??}}
| CASNo = 1054-88-2
| PubChem = 5268
| IUPHAR_ligand = 53
| SMILES = O=C2NCN(c1ccccc1)C23CCN(CC3)CC4Oc5ccccc5OC4
| MeSHName = Spiroxatrine
  }}

| Section2 = {{Chembox Properties
| C=22 | H=25 | N=3 | O=3 
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
  }}

| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
  }}
}}

'''Spiroxatrine''' ('''Spiroxamide''', '''R5188''') is a drug which acts as a selective [[Antagonist (pharmacology)|antagonist]] at both the [[5-HT1A receptor|5-HT<sub>1A</sub> receptor]] and the [[Alpha-2C adrenergic receptor|α<sub>2C</sub>]] [[adrenergic receptor]].<ref>{{Cite journal | pmid = 8105762 | year = 1993 | last1 = Terrón | first1 = J. A. | title = The alpha-antiadrenergic properties of spiroxatrine, a ligand of serotonergic 5-HT1A receptors | journal = Archivos del Instituto de Cardiología de México | volume = 63 | issue = 4 | pages = 289–95 | last2 = Ibarra | first2 = M | last3 = Ransanz | first3 = V | last4 = Hong | first4 = E | last5 = Villalón | first5 = C. M. }}</ref> It is an [[structural analog|analog]] of [[spiperone]] and also has some [[dopamine antagonist]] effects and a relatively weak [[opioid]] action.<ref>NIEMEGEERS CJ, VERBRUGGEN FJ, VANNUETEN JM, JANSSEN PA. SPIROXAMIDE (R 5188): A NEW COMPOUND PRODUCING MORPHINE-LIKE AND CHLORPROMAZINE-LIKE EFFECTS IN ANIMALS. ''Int J Neuropharmacol''. 1963 Dec;2:349-54. {{doi|10.1016/0028-3908(63)90010-8}} {{pmid|14119495}}</ref><ref>Leysen J, Tollenaere JP, Koch MHJ, Laduron P. Differentiation of opiate and neuroleptic receptor binding in rat brain. ''European Journal of Pharmacology'' 1977; 43(3):253-267. {{doi|10.1016/0014-2999(77)90025-5}}</ref>

==References==
{{Reflist}}

{{Navboxes
| title = [[Pharmacodynamics]]
| titlestyle = background:#ccccff
| list1 = 
{{Adrenergic receptor modulators}}
{{Dopamine receptor modulators}}
{{Serotonin receptor modulators}}
{{Xenobiotic-sensing receptor modulators}}
}}

[[Category:5-HT1A antagonists]]
[[Category:Abandoned drugs]]
[[Category:Alpha-2 blockers]]
[[Category:Benzodioxans]]
[[Category:Dopamine antagonists]]
[[Category:Imidazolidinones]]
[[Category:Spiro compounds]]


{{Nervous-system-drug-stub}}