View source for Procymidone

{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 417479908
| ImageFile = Procymidone.svg
| ImageSize =
| IUPACName = 3-(3,5-dichlorophenyl)-1,5-dimethyl-3-azabicyclo[3.1.0]hexane-2,4-dione
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo_Ref = {{cascite|correct|CAS}}
| CASNo = 32809-16-8
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = EC2FI67U2Y
|  PubChem = 36242
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 513678
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C10986
| SMILES = Clc1cc(cc(Cl)c1)N2C(=O)C3(C)CC3(C)C2=O
|  ChemSpiderID = 33326
|  StdInChI = 1S/C13H11Cl2NO2/c1-12-6-13(12,2)11(18)16(10(12)17)9-4-7(14)3-8(15)5-9/h3-5H,6H2,1-2H3
|  StdInChIKey = QXJKBPAVAHBARF-UHFFFAOYSA-N
 }}
|Section2={{Chembox Properties
| C=13 | H=11 | Cl=2 | N=1 | O=2
| MolarMass = 284.138 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility = }}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt = }}
}}

'''Procymidone''' is a [[pesticide]]. It is often used for killing unwanted ferns and nettles, and as a [[dicarboximide fungicides|dicarboximide fungicide]] for killing fungi, for example as seed dressing, pre-harvest spray or post-harvest dip of lupins, grapes, stone fruit, strawberries.<ref>{{cite web|last=Australian Pesticides and Veterinary Medicine Authority|title=Chemical Review Program/Procymidone|url=http://www.apvma.gov.au/products/review/current/procymidone.php|access-date=9 February 2012|archive-url=https://web.archive.org/web/20120126165201/http://www.apvma.gov.au/products/review/current/procymidone.php|archive-date=26 January 2012|url-status=dead}}</ref>  It is a known [[endocrine disruptor]] ([[androgen receptor]] [[receptor antagonist|antagonist]]){{Citation needed|date=December 2019|reason=removed citation to predatory publisher content}} which interferes with the sexual differentiation of male rats.<ref>{{cite journal|vauthors=Ostby J, Kelce WR, Lambright C, Wolf CJ, Mann P, Gray LE |title=The fungicide procymidone alters sexual differentiation in the male rat by acting as an androgen-receptor antagonist in vivo and in vitro|journal=Toxicol Ind Health|year=1999|volume=15|issue=1–2|pages=80–93|pmid=10188193|doi=10.1191/074823399678846718}}</ref>  It is considered to be a poison.<ref>{{cite web|last=Australian Pesticides and Veterinary Medicine Authority, Chemical Review Program|title=procymidone_poster.pdf|url=http://www.apvma.gov.au/products/review/docs/procymidone_poster.pdf|access-date=9 February 2012|archive-url=https://web.archive.org/web/20120227172545/http://www.apvma.gov.au/products/review/docs/procymidone_poster.pdf|archive-date=27 February 2012|url-status=dead}}</ref>

==See also==
* [[Phenothrin]]
* [[Prochloraz]]
* [[Vinclozolin]]

==References==
{{Reflist}}

==External links==
* {{PPDB|537}}

{{Androgen receptor modulators}}

[[Category:Chlorobenzene derivatives]]
[[Category:Endocrine disruptors]]
[[Category:Imides]]
[[Category:Nonsteroidal antiandrogens]]
[[Category:Pesticides]]
[[Category:Heterocyclic compounds with 2 rings]]
[[Category:Lactams]]

{{alkanederivative-stub}}