View source for Methylbutyltryptamine

{{Short description|Chemical compound}}
{{Infobox drug
| drug_name = Methylbutyltryptamine
| image = MBT.svg
| width = 
| caption = 

<!-- Clinical data -->
| pronounce = 
| tradename = 
| Drugs.com = 
| MedlinePlus = 
| licence_CA = 
| licence_EU = 
| DailyMedID = 
| licence_US = 
| pregnancy_AU = 
| pregnancy_category = 
| dependency_liability = 
| addiction_liability = 
| routes_of_administration = 
| class = 
| ATC_prefix = 
| ATC_suffix = 

<!-- Legal status -->
| legal_status = 

<!-- Pharmacokinetic data -->
| bioavailability = 
| protein_bound = 
| metabolism = 
| metabolites = 
| onset = 
| elimination_half-life = 
| duration_of_action = 
| excretion = 

<!-- Identifiers -->
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 848130-12-1
| CAS_supplemental = 
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = UQ2K8W783S
| PubChem = 44719457
| IUPHAR_ligand = 
| DrugBank = 
| ChemSpiderID = 21106349
| KEGG = 
| ChEBI = 
| ChEMBL = 
| NIAID_ChemDB = 
| PDB_ligand = 
| DTXSID = DTXSID501016744
| synonyms = 

<!-- Chemical data -->
| IUPAC_name = ''N''-[2-(1''H''-indol-3-yl)ethyl]-''N''-methylbutan-1-amine
| C=15 | H=22 | N=2
| SMILES = CCCCN(C)CCC1=CNC2=CC=CC=C21
| StdInChI = 1S/C15H22N2/c1-3-4-10-17(2)11-9-13-12-16-15-8-6-5-7-14(13)15/h5-8,12,16H,3-4,9-11H2,1-2H3
| StdInChIKey = PUEYINPKMCBJCA-UHFFFAOYSA-N
}}

'''MBT''', or '''''N''-[[methyl]]-''N''-[[butyl]][[tryptamine]]''', is a lesser-known [[psychedelic drug]]. MBT was first synthesized by [[Alexander Shulgin]]. In his book ''[[TiHKAL]]'' (''Tryptamines I Have Known and Loved''), the minimum dosage is listed as 250-400 [[Milligram|mg]], and the duration listed as 4–6 hours. MBT produces a heavy [[body load]] with [[dehydration]], and causes visuals similar to those of [[dimethyltryptamine|DMT]]. Very little data exists about the pharmacological properties, metabolism, and toxicity of MBT.

== MSBT ==
TiHKAL mentions that a structural isomer of MBT exists, with the butyl group attached at the nitrogen atom.  It is known as '''''N-s''-[[butyl]]-''N''-[[methyl]][[tryptamine]]''', or '''MSBT'''.  However, little is known about its psychoactivity.

== See also ==
* [[Tryptamine]]
* [[Psychedelics, dissociatives and deliriants]]

== External links ==
* [http://www.erowid.org/library/books_online/tihkal/tihkal27.shtml MBT Entry in ''TIHKAL'']
* [http://tihkal.info/read.php?domain=tk&id=27 MBT entry in TiHKAL • info]

{{Psychedelics}}
{{Tryptamines}}

[[Category:N,N-Dialkyltryptamines]]
[[Category:Psychedelic tryptamines]]


{{Psychoactive-stub}}