View source for Fluocinonide

{{Short description|Chemical compound}}
{{Redirect-distinguish|Vanos|VANOS|VanossGaming}}
{{Use dmy dates|date=January 2024}}
{{cs1 config |name-list-style=vanc |display-authors=6}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 461101571
| image = Fluocinonide.png
| alt = 

<!--Clinical data-->
| tradename = Fluonex, Lidex, others<ref>{{cite web | url = https://www.nlm.nih.gov/medlineplus/druginfo/medmaster/a601054.html | work = MedlinePlus Drug Information | title = Fluocinonide Topical | publisher = U.S. National Library of Medicine }}</ref>
| Drugs.com = {{drugs.com|CONS|fluocinonide}}
| MedlinePlus = a601054
| pregnancy_category = 
| routes_of_administration = [[Topical administration|Topical]]
| ATC_prefix = C05
| ATC_suffix = AA11
| ATC_supplemental =  {{ATC|D07|AC08}}, {{ATCvet|C05|AA11}}, {{ATCvet|D07|AC08}}

| legal_AU = S4
| legal_UK = POM
| legal_US = Rx-only
| legal_status =  

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism = [[Liver]]
| elimination_half-life =  

<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 356-12-7
| PubChem = 9642
| IUPHAR_ligand = 7078
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB01047
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 9265
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 2W4A77YPAN
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00325
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 1501

<!--Chemical data-->
| IUPAC_name = 6α,9-difluoro-11β,16α,17,21-tetrahydroxypregna-1,4-diene-3,20-dione, cyclic 16,17-acetal with acetone,21-acetate
| C=26 | H=32 | F=2 | O=7
| smiles = O=C(OCC(=O)[C@]45OC(O[C@@H]5C[C@@H]2[C@@]4(C[C@H](O)[C@]3(F)[C@]/1(/C=C\C(=O)\C=C\1[C@@H](F)C[C@@H]23)C)C)(C)C)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C26H32F2O7/c1-13(29)33-12-20(32)26-21(34-22(2,3)35-26)10-15-16-9-18(27)17-8-14(30)6-7-23(17,4)25(16,28)19(31)11-24(15,26)5/h6-8,15-16,18-19,21,31H,9-12H2,1-5H3/t15-,16-,18-,19-,21+,23-,24-,25-,26+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = WJOHZNCJWYWUJD-IUGZLZTKSA-N
}}

'''Fluocinonide''' is a potent [[glucocorticoid]] used [[topical]]ly as an [[anti-inflammatory]] agent for the treatment of [[skin disorder]]s such as [[eczema]] and [[seborrhoeic dermatitis]].<ref name=":1">{{Cite web |title=Fluocinonide Topical: MedlinePlus Drug Information |url=https://medlineplus.gov/druginfo/meds/a601054.html |access-date=16 November 2022 |website=medlineplus.gov |language=en}}</ref> It relieves [[itch]]ing, redness, [[Xeroderma|dryness]], crusting, scaling, [[inflammation]], and discomfort.<ref name=":1" />

A common potential adverse effect is skin atrophy (thinning of the skin).<ref name=":0">{{cite journal | vauthors = Jablonska S, Groniowska M, Dabroswki J | title = Comparative evaluation of skin atrophy in man induced by topical corticoids | journal = The British Journal of Dermatology | volume = 100 | issue = 2 | pages = 193–206 | date = February 1979 | pmid = 154921 | doi = 10.1111/j.1365-2133.1979.tb05561.x | s2cid = 30656827 }}</ref>

In 2022, it was the 266th most commonly prescribed medication in the United States, with more than 1{{nbsp}}million prescriptions.<ref>{{cite web | title=The Top 300 of 2022 | url=https://clincalc.com/DrugStats/Top300Drugs.aspx | website=ClinCalc | access-date=30 August 2024 | archive-date=30 August 2024 | archive-url=https://web.archive.org/web/20240830202410/https://clincalc.com/DrugStats/Top300Drugs.aspx | url-status=live }}</ref><ref>{{cite web | title = Fluocinonide Drug Usage Statistics, United States, 2013 - 2022 | website = ClinCalc | url = https://clincalc.com/DrugStats/Drugs/Fluocinonide | access-date = 30 August 2024 }}</ref>

== Veterinary uses ==
Fluocinonide is used in veterinary medicine. It is a treatment for allergies in dogs.<ref>{{cite report | title = Dog Allergies <!-- | url = https://www.squidoo.com/dogallergy | archive-url = https://web.archive.org/web/20120607075556/www.squidoo.com/dogallergy | archive-date = 7 June 2012 --> | work = Squidoo }}</ref> Natural systemic cortisol concentrations can be suppressed for weeks after one week of topical exposure.<ref>{{cite journal | vauthors = Zenoble RD, Kemppainen RJ | title = Adrenocortical suppression by topically applied corticosteroids in healthy dogs | journal = Journal of the American Veterinary Medical Association | volume = 191 | issue = 6 | pages = 685–688 | date = September 1987 | doi = 10.2460/javma.1987.191.06.685 | pmid = 2824410 }}</ref>

== References ==
{{Reflist}}

{{Glucocorticoids}}
{{Vasoprotectives}}
{{Glucocorticoidics}}
{{Portal bar | Medicine}}
{{Authority control}}

[[Category:Acetate esters]]
[[Category:Acetonides]]
[[Category:Cyclohexanols]]
[[Category:Corticosteroid cyclic ketals]]
[[Category:Corticosteroid esters]]
[[Category:Organofluorides]]
[[Category:Glucocorticoids]]
[[Category:Pregnanes]]
[[Category:Diketones]]
[[Category:Enones]]
[[Category:Fluorinated corticosteroids]]