View source for Fludroxycortide

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 461101313
| IUPAC_name = 6-Fluoro-11,21-dihydroxy-16,17-[(l-methylethylidene)bis(oxy)]-(6α,11β,16α)-pregn-4-ene-3,20-dione
| image = Fludroxycortide.svg
| width = 250

<!--Clinical data-->
| tradename = Cordran, Haelan
| Drugs.com = {{drugs.com|CONS|fludroxycortide}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category = 
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
| legal_UK = POM
| legal_US = <!-- OTC / Rx-only -->
| legal_status = 
| routes_of_administration = Topical

<!--Pharmacokinetic data-->
| bioavailability = 
| protein_bound = 
| metabolism = 
| elimination_half-life = 
| excretion = 

<!--Identifiers-->
| IUPHAR_ligand = 7606
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 1524-88-5
| ATC_prefix = D07
| ATC_suffix = AC07
| ATC_supplemental =  
| PubChem = 15209
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00846
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 14475
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8EUL29XUQT
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D00328
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1201012

<!--Chemical data-->
| C=24 | H=33 | F=1 | O=6
| SMILES = O=C1\C=C5/[C@](C)(CC1)[C@@H]2[C@H]([C@H]3[C@](C[C@@H]2O)([C@@]4(OC(O[C@@H]4C3)(C)C)C(=O)CO)C)C[C@@H]5F
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C24H33FO6/c1-21(2)30-19-9-14-13-8-16(25)15-7-12(27)5-6-22(15,3)20(13)17(28)10-23(14,4)24(19,31-21)18(29)11-26/h7,13-14,16-17,19-20,26,28H,5-6,8-11H2,1-4H3/t13-,14-,16-,17-,19+,20+,22-,23-,24+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = POPFMWWJOGLOIF-XWCQMRHXSA-N
| synonyms = 6α-Fluoro-16α-hydroxyhydrocortisone 16,17-acetonide; 6α-Fluoro-11β,16α,17α,21-tetrahydroxypregn-4-ene-3,20-dione 16,17-acetonide
}}

'''Fludroxycortide''' ([[International Nonproprietary Name|INN]], [[British Approved Name|BAN]], [[Japanese Accepted Name|JAN]]), also known as '''flurandrenolide''' ([[United States Adopted Name|USAN]]) and '''flurandrenolone''',<ref>{{PubChemLink|15209}}</ref> is a [[synthetic compound|synthetic]] [[topical steroid|topical corticosteroid]] and is used as an [[anti-inflammatory]] treatment for use on [[skin]] irritations. Trade names include '''Haelan''' ([[Typharm]], UK) and '''Cordran''' (by [[Actavis|Watson Pharmaceuticals]], US).<ref>{{cite web | work = Drugs.com | url = https://www.drugs.com/international/fludroxycortide.html | title = Fludroxycortide | access-date = 2018-01-23 | archive-date = 2019-08-29 | archive-url = https://web.archive.org/web/20190829112244/https://www.drugs.com/international/fludroxycortide.html | url-status = dead }}</ref><ref>{{cite web | work = Patient.info | url = http://patient.info/medicine/fludroxycortide-for-inflammatory-skin-conditions-haelan | title = Fludroxycortide | date = 30 August 2022 }}</ref>

Fludroxycortide is available in ointment, cream and as an impregnated tape ('''Haelan tape''', '''Cordran tape'''). Licensed indications in the United Kingdom include recalcitrant [[dermatoses]].<ref>[http://www.typharm.com/typharm/docs/Haelan_Tape_SPC.pdf Haelan Tape Summary of Product Characteristics]{{Dead link|date=December 2019 |bot=InternetArchiveBot |fix-attempted=yes }}</ref><ref>{{cite journal | vauthors = Nakamura H, Motoyoshi S, Ishii K, Seto Y, Shimizu M | title = [Anti-inflammatory activity of a topical glucocorticoid, fludroxycortide tape in experimental animals (author's transl)] | journal = Nihon Yakurigaku Zasshi. Folia Pharmacologica Japonica | volume = 76 | issue = 7 | pages = 595–607 | date = October 1980 | pmid = 7215997 | doi = 10.1254/fpj.76.595 | doi-access = free }}</ref>

== References ==
{{Reflist|30em}}

{{Glucocorticoids and antiglucocorticoids}}
{{Glucocorticoid receptor modulators}}

[[Category:Acetonides]]
[[Category:Primary alcohols]]
[[Category:Cyclohexanols]]
[[Category:Corticosteroid cyclic ketals]]
[[Category:Corticosteroids]]
[[Category:Diketones]]
[[Category:Organofluorides]]
[[Category:Glucocorticoids]]
[[Category:Pregnanes]]

{{dermatologic-drug-stub}}