View source for Felbinac

{{Short description|Topical NSAID medication}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 443752362
| IUPAC_name = biphenyl-4-ylacetic acid
| image = Felbinac.svg
| image_class = skin-invert-image

<!--Clinical data-->
| tradename =  
| Drugs.com = {{drugs.com|international|felbinac}}
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B            / C / D / X -->
| pregnancy_category =  
| legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 -->
| legal_CA = <!--             / Schedule I, II, III, IV, V, VI, VII, VIII -->
| legal_UK = P
| legal_US = <!-- OTC                   / Rx-only  / Schedule I, II, III, IV, V -->
| legal_status =  
| routes_of_administration = Topical

<!--Pharmacokinetic data-->
| bioavailability =  
| protein_bound =  
| metabolism =  
| elimination_half-life =  
| excretion =

<!--Identifiers-->
| CAS_number = 5728-52-9
| ATC_prefix = M02
| ATC_suffix = AA08
| PubChem = 3332
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB07477
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 3215
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 94WNJ5U8L7
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01675
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 31597
| ChEMBL_Ref = {{ebicite|correct|EBI}}
| ChEMBL = 413965

<!--Chemical data-->
| C=14 | H=12 | O=2 
| smiles = O=C(O)Cc1ccc(cc1)c2ccccc2
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H12O2/c15-14(16)10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H,15,16)
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QRZAKQDHEVVFRX-UHFFFAOYSA-N
}}

'''Felbinac''' ([[International Nonproprietary Name|INN]], or '''biphenylylacetic acid''') is a [[topical]] medicine,<ref>''The Merck Index'', 12th Edition. 3989</ref> belonging to the family of medicines known as [[nonsteroidal anti-inflammatory drug]]s (NSAIDs) of the arylacetic acid (not arylpropionic acid) class, which is used to treat muscle inflammation and [[arthritis]].<ref>Description of Felbinac on Tiscali [https://web.archive.org/web/20060929171650/http://www.tiscali.co.uk/lifestyle/healthfitness/health_advice/netdoctor/archive/100003440.html]</ref> It is an active metabolite of [[fenbufen]].<ref name="KTWE1980">{{cite journal |vauthors=Kohler C, Tolman E, Wooding W, Ellenbogen L | title=A review of the effects of fenbufen and a metabolite, biphenylacetic acid, on platelet biochemistry and function | journal=Arzneimittelforschung | volume=30 | issue=4A | pages=702–707 | year=1980 | pmid=6254545}}</ref>

==Related compounds==
The α-methyl acid of felbinac is called [[biprofen]] and is used to prepare [[bifepramide]].  The α-ethyl acid is called [[xenbucin]] which is used to make [[xenthiorate]].

==See also==
*[[Fluenetil]]

== References ==
{{Reflist}}

{{NSAIDs}}
{{Topical products for joint and muscular pain}}
{{Prostanoidergics}}

[[Category:Nonsteroidal anti-inflammatory drugs]]


{{musculoskeletal-drug-stub}}