View source for Cefaloglycin

{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| verifiedrevid = 460022500
| IUPAC_name = (6''R'',7''R'')-3-[(acetyloxy)methyl]-7-{[(2''R'')-2-amino-2-phenylacetyl]amino}-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid
| image = Cefaloglycin.svg
<!--Clinical data-->
| tradename =
| pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X -->
| pregnancy_US = <!-- A / B / C / D / X -->
| pregnancy_category =
| legal_AU = <!-- Unscheduled / S2 / S4 / S8 -->
| legal_UK = <!-- GSL / P / POM / CD -->
| legal_US = <!-- OTC / Rx-only -->
| legal_status =
| routes_of_administration =
<!--Pharmacokinetic data-->
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
<!--Identifiers-->
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 3577-01-3
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| PubChem = 19150
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank = DB00689
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 18069
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = HD2D469W6U
| KEGG_Ref = {{keggcite|correct|kegg}}
| KEGG = D01949
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 34613
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200971
<!--Chemical data-->
| C=18 | H=19 | N=3 | O=6 | S=1
| smiles = O=C2N1/C(=C(\CS[C@@H]1[C@@H]2NC(=O)[C@@H](c3ccccc3)N)COC(=O)C)C(=O)O
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C18H19N3O6S/c1-9(22)27-7-11-8-28-17-13(16(24)21(17)14(11)18(25)26)20-15(23)12(19)10-5-3-2-4-6-10/h2-6,12-13,17H,7-8,19H2,1H3,(H,20,23)(H,25,26)/t12-,13-,17-/m1/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = FUBBGQLTSCSAON-PBFPGSCMSA-N
}}
'''Cefaloglycin''' [[International Nonproprietary Name|INN]] (also spelled '''cephaloglycin''') is a first-generation [[cephalosporin]] [[antibiotic]].

==References==
*{{cite journal |vauthors=Tune B, Hsu C | title = The renal mitochondrial toxicity of beta-lactam antibiotics: in vitro effects of cephaloglycin and imipenem. | journal = J Am Soc Nephrol | volume = 1 | issue = 5 | pages = 815–21 | year = 1990 | doi = 10.1681/ASN.V15815 | pmid = 2133431| doi-access = free }}
*{{cite journal |vauthors=Tune B, Fravert D, Hsu C | title = Oxidative and mitochondrial toxic effects of cephalosporin antibiotics in the kidney. A comparative study of cephaloridine and cephaloglycin. | journal = Biochem Pharmacol | volume = 38 | issue = 5 | pages = 795–802 | year = 1989 | pmid = 2930580 | doi = 10.1016/0006-2952(89)90233-5| doi-access = free }}

==External links==
*{{Commonscatinline|Cefaloglycin}}

{{CephalosporinAntiBiotics}}

[[Category:Cephalosporin antibiotics]]
[[Category:Acetate esters]]
[[Category:Enantiopure drugs]]


{{antibiotic-stub}}
{{stereochemistry-stub}}