View source for 7-Hydroxyamoxapine

{{Short description|Chemical compound}}
{{Infobox drug
| drug_name = 
| image = 7-Hydroxyamoxapine.svg
| width = 200
| alt = Chemical structure of 7-Hydroxyamoxapine

<!-- Clinical data -->
| pronounce = 
| tradename = 
| Drugs.com = 
| MedlinePlus = 
| licence_CA = 
| licence_EU = 
| DailyMedID = 
| licence_US = 
| pregnancy_AU = 
| pregnancy_category = 
| dependency_liability = 
| addiction_liability = 
| routes_of_administration = 
| class = 
| ATC_prefix = 
| ATC_suffix = 

<!-- Legal status -->
| legal_status = 

<!-- Pharmacokinetic data -->
| bioavailability = 
| protein_bound = 
| metabolism = 
| metabolites = 
| onset = 
| elimination_half-life = 6.5 hours
| duration_of_action = 
| excretion = 

<!-- Identifiers -->
| CAS_number = 37081-76-8
| CAS_supplemental = 
| PubChem = 162242
| IUPHAR_ligand = 
| DrugBank = 
| ChemSpiderID = 142472
| UNII = 9Z11F654NR
| KEGG = 
| ChEBI = 143288
| ChEMBL = 
| NIAID_ChemDB = 
| PDB_ligand = 
| synonyms = 

<!-- Chemical data -->
| IUPAC_name = 2-Chloro-11-(piperazin-1-yl)dibenzo [b,f][1,4]oxazepin-7-ol
| C=17 | H=16 | Cl=1 | N=3 | O=2
| SMILES = C1CN(CCN1)C2=NC3=C(C=C(C=C3)O)OC4=C2C=C(C=C4)Cl
| StdInChI = 1S/C17H16ClN3O2/c18-11-1-4-15-13(9-11)17(21-7-5-19-6-8-21)20-14-3-2-12(22)10-16(14)23-15/h1-4,9-10,19,22H,5-8H2
| StdInChIKey = MEUGUMOVYNSGEW-UHFFFAOYSA-N
}}

'''7-Hydroxyamoxapine''' is an [[active metabolite]] of the [[antidepressant]] drug [[amoxapine]] (Asendin). It contributes to amoxapine's pharmacology.<ref>{{cite journal | vauthors = Jue SG, Dawson GW, Brogden RN | title = Amoxapine: a review of its pharmacology and efficacy in depressed states | journal = Drugs | volume = 24 | issue = 1 | pages = 1–23 | date = July 1982 | pmid = 7049659 | doi = 10.2165/00003495-198224010-00001 | s2cid = 7279867 }}</ref><ref>{{cite journal | vauthors = Calvo B, García MJ, Pedraz JL, Mariño EL, Domínguez-Gil A | title = Pharmacokinetics of amoxapine and its active metabolites | journal = International Journal of Clinical Pharmacology, Therapy, and Toxicology | volume = 23 | issue = 4 | pages = 180–185 | date = April 1985 | pmid = 3997304 }}</ref> It is a [[dopamine receptor antagonist]] and contributes to amoxapine's [[antipsychotic]] properties.<ref name="pmid10507241">{{cite journal | vauthors = Midha KK, Hubbard JW, McKay G, Rawson MJ, Hsia D | title = The role of metabolites in a bioequivalence study II: amoxapine, 7-hydroxyamoxapine, and 8-hydroxyamoxapine | journal = International Journal of Clinical Pharmacology and Therapeutics | volume = 37 | issue = 9 | pages = 428–438 | date = September 1999 | pmid = 10507241 }}</ref><ref name="pmid6126130">{{cite journal | vauthors = Cohen BM, Harris PQ, Altesman RI, Cole JO | title = Amoxapine: neuroleptic as well as antidepressant? | journal = The American Journal of Psychiatry | volume = 139 | issue = 9 | pages = 1165–1167 | date = September 1982 | pmid = 6126130 | doi = 10.1176/ajp.139.9.1165 }}</ref>

== See also ==
* [[8-Hydroxyamoxapine]]

== References ==
{{Reflist}}

{{Antidepressants}}
{{Anxiolytics}}
{{Antipsychotics}}
{{Adrenergics}}
{{Dopaminergics}}
{{Histaminergics}}
{{Serotonergics}}
{{Tricyclics}}

{{DEFAULTSORT:Hydroxyamoxapine, 7-}}
[[Category:Dibenzoxazepines]]
[[Category:1-Piperazinyl compounds]]
[[Category:Tricyclic antidepressants]]
[[Category:Chloroarenes]]
[[Category:Hydroxyarenes]]
[[Category:Human drug metabolites]]

{{nervous-system-drug-stub}}