View source for 3C-P

{{short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 477220361
| IUPAC_name = 1-(3,5-Dimethoxy-4-propoxyphenyl)propan-2-amine
| image = 3C-P_2d-skeletal.svg
| width = 200

<!--Clinical data-->
| tradename =  
| legal_DE = NpSG
| legal_UK = Class A

<!--Identifiers-->
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 501700-11-4  
| PubChem = 54929142
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 21106238
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 4KRX4MHV7L 


<!--Chemical data-->
| C=14 | H=23 | N=1 | O=3 
| smiles = CC(N)Cc1cc(OC)c(OCCC)c(c1)OC
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C14H23NO3/c1-5-6-18-14-12(16-3)8-11(7-10(2)15)9-13(14)17-4/h8-10H,5-7,15H2,1-4H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = KKMCHCCXGKYEKJ-UHFFFAOYSA-N
}}

'''3C-P''', also known as '''4-propoxy-3,5-dimethoxyamphetamine''', is a [[psychedelic drug|psychedelic]] [[phenethylamine]]. It has structural and pharmacodynamic properties similar to the drugs [[mescaline]], [[proscaline]], and [[amphetamine]].  Little information exists on the human [[pharmacology]] of 3C-P, but a psychedelic dosage appears to be 20–40&nbsp;mg,<ref name="HalberstadtChathaKlein2020">{{cite journal | vauthors = Halberstadt AL, Chatha M, Klein AK, Wallach J, Brandt SD | title = Correlation between the potency of hallucinogens in the mouse head-twitch response assay and their behavioral and subjective effects in other species | journal = Neuropharmacology | volume = 167 | issue = | pages = 107933 | date = May 2020 | pmid = 31917152 | pmc = 9191653 | doi = 10.1016/j.neuropharm.2019.107933 | url = http://usdbiology.com/cliff/Courses/Advanced%20Seminars%20in%20Neuroendocrinology/Serotonergic%20Psychedelics%2020/Halberstadt%2020%20Neuropharm%20potency%20of%20hallucinogens%20%20head-twitch.pdf | quote = Table 4 Human potency data for selected hallucinogens. [...] }}</ref> and is accompanied by [[stimulant]] and [[Psychedelic experience|psychedelic]] effects such as visual enhancement and distortion.{{medcn|date=February 2018}} It can be synthesized from [[syringaldehyde]] by reaction with [[n-Propyl iodide|''n''-propyl iodide]] followed by condensation with nitroethane and reduction.<ref>{{cite journal| vauthors = Trachsel D |title=Synthese von neuen (Phenylalkyl)aminen zur Untersuchung von Struktur-Aktivitätsbeziehungen, Mitteilung 1, Mescalin Derivate|journal=Helvetica Chimica Acta|date=September 2002|volume=85|issue=9|pages=3019–3026|doi=10.1002/1522-2675(200209)85:9<3019::AID-HLCA3019>3.0.CO;2-4}}</ref> 3C-P acts as a [[serotonin]] [[5-HT2 receptor|5-HT<sub>2</sub> receptor]] [[agonist]].<ref name="WallachCaoCalkins2023">{{cite journal | vauthors = Wallach J, Cao AB, Calkins MM, Heim AJ, Lanham JK, Bonniwell EM, Hennessey JJ, Bock HA, Anderson EI, Sherwood AM, Morris H, de Klein R, Klein AK, Cuccurazzu B, Gamrat J, Fannana T, Zauhar R, Halberstadt AL, McCorvy JD | title = Identification of 5-HT2A receptor signaling pathways associated with psychedelic potential | journal = Nat Commun | volume = 14 | issue = 1 | pages = 8221 | date = December 2023 | pmid = 38102107 | pmc = 10724237 | doi = 10.1038/s41467-023-44016-1 | url = https://bitnest.netfirms.com/external/10.1038/s41467-023-44016-1}}</ref>

3C-P has been sold online as a [[designer drug]] and was first detected in September 2013 in Finland.<ref>{{Cite web |title=EMCDDA–Europol 2013 Annual Report on the implementation of Council Decision 2005/387/JHA {{!}} www.euda.europa.eu |url=https://www.euda.europa.eu/publications/implementation-reports/2013_en |access-date=2025-05-11 |website=www.euda.europa.eu}}</ref>

==See also==
* [[3C (psychedelics)]]
* [[3C-AL]]
* [[3C-MAL]]

==References==
{{Reflist}}

==External links==
* [http://www.erowid.org/chemicals/3cp/3cp.shtml Erowid 3C-P Information]

{{Psychedelics}}
{{Serotonin receptor modulators}}
{{Phenethylamines}}

[[Category:5-HT2A agonists]]
[[Category:5-HT2B agonists]]
[[Category:5-HT2C agonists]]
[[Category:3C (psychedelics)]]
[[Category:Designer drugs]]
[[Category:Entheogens]]
[[Category:Drugs not assigned an ATC code]]
[[Category:Methoxy compounds]]
[[Category:O-methylated phenols]]
[[Category:Propoxy compounds]]


{{hallucinogen-stub}}