View source for 4-Phenyl-4-(1-piperidinyl)cyclohexanol

{{chembox
|Verifiedfields = changed
|Watchedfields = changed
|verifiedrevid = 477223305
|Name = 4-Phenyl-4-(1-piperidinyl)cyclohexanol
|ImageFile = 4-phenyl-4-(1-piperidinyl)cyclohexanol-Line-Structure.png 
|PIN = 4-Phenyl-4-(piperidin-1-yl)cyclohexan-1-ol
|OtherNames = 4-Phenyl-4-(1-piperidinyl)cyclohexanol
|Section1 = {{Chembox Identifiers
|ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
|ChemSpiderID = 142418
|InChI = 1/C17H25NO/c19-16-9-11-17(12-10-16,15-7-3-1-4-8-15)18-13-5-2-6-14-18/h1,3-4,7-8,16,19H,2,5-6,9-14H2
|InChIKey = KPRUAZBLIREHPD-UHFFFAOYAM
|SMILES1 = OC3CCC(c1ccccc1)(N2CCCCC2)CC3
|StdInChI_Ref = {{stdinchicite|correct|chemspider}}
|StdInChI = 1S/C17H25NO/c19-16-9-11-17(12-10-16,15-7-3-1-4-8-15)18-13-5-2-6-14-18/h1,3-4,7-8,16,19H,2,5-6,9-14H2
|StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
|StdInChIKey = KPRUAZBLIREHPD-UHFFFAOYSA-N
|CASNo_Ref = {{cascite|correct|CAS}}
|CASNo = 60756-83-4
|UNII_Ref = {{fdacite|correct|FDA}}
|UNII = TAJ3PEY6RN
|PubChem = 162171
|SMILES = OC1CCC(N2CCCCC2)(C3=CC=CC=C3)CC1 
}}
|Section2 = {{Chembox Properties
|Formula = C<sub>17</sub>H<sub>25</sub>NO 
|MolarMass = 259.391 g/mol 
}}
}}

'''4-Phenyl-4-(1-piperidinyl)cyclohexanol''', also known as '''PPC''', is an [[organic chemistry|organic chemical]] which is a [[metabolite]] of [[phencyclidine]] (PCP).<ref>{{cite journal | author = Nabeshima, Toshitaka | author2 = Yamaguchi, Kazumasa | author3 = Fukaya, Hiroaki | author4 = Hiramatsu, Masayuki | author5 = Furukawa, Hiroshi | author6 = Kameyama, Tsutomu | title = Simultaneous determination of phencyclidine and its major metabolites in biological samples by high-performance liquid chromatography | journal = Research Communications in Substances of Abuse | year = 1985 | volume = 6 | issue = 2 | pages = 65–78}}</ref>  It can be detected in the hair of PCP users.<ref>{{Cite journal | author = Nakahara, Yuji | author2 = Takahashi, Kazunori | author3 = Sakamoto, Tomoaki | author4 = Tanaka, Akira | author5 = Hill, Virginia A. | author6 = Baumgartner, Werner A. | title = Hair analysis for drugs of abuse XVII. Simultaneous detection of PCP, PCHP, and PCPdiol in human hair for confirmation of PCP use | journal = Journal of Analytical Toxicology  | year = 1997 | volume = 21 | issue = 5 | pages = 356–362 | pmid = 9288587 | doi=10.1093/jat/21.5.356| doi-access = free }}</ref>

PPC has been shown to cause [[hyperlocomotion|increases in locomotor activity]] in lab mice.<ref>{{cite web|url=http://cat.inist.fr/?aModele=afficheN&cpsidt=3299882|title=Behavioral effects of phencyclidine and its major metabolite, (trans)4-phenyl-4-(1-piperidinyl)cyclohexanol, in mice}}</ref>

==See also==
* [[PCHP]], another PCP metabolite

==References==
{{reflist}}

{{amine-stub}}
{{DEFAULTSORT:Phenyl-4-(1-piperidinyl)cyclohexanol, 4-}}

[[Category:Arylcyclohexylamines]]
[[Category:Secondary alcohols]]
[[Category:1-Piperidinyl compounds]]
[[Category:Recreational drug metabolites]]
[[Category:Tertiary amines]]